theil

Spending most of my time at the moment on a research project which has to do with common societal ideas of drugs and their benefits and harms. Ironically what I've found so far is most people say marijuana is the only drug with any possible health benefit. They describe the next safest drugs as being ones that are commonly used recreationally but unfortunately don't really have any acceptable medical use. For example people will say that Psilocybin/Psilocin(Shrooms) are more or less safe they know a bunch of people who've done em and never had a problem. However they will say something like GHB is only good if you want to be a serial rapist despite the fact that it is a prescribed drug in other countries with a whole host of different methods of action i.e. cataplaxy in narcoleptics treatment of various other sleep disorders for use during labor alleviating the symptoms associated with alcohol withdrawl as an adjunct to therapy and as a way to trigger releases of hGH just to state a few. I'm also trying to figure out why people when they think something is natural it is a clean bill of health to use and when something is chemically synthesized it all of a sudden becomes exponentially more dangerous so hopefully i'll have all my research done in the next month or so and then it comes time to compile it and write a paper and all that fun stuff. I can't wait to get it done it's so much fun

My mom's birthday was yesterday i got her these socks with patterns on them for the upcoming holidays cause she loves that sort of stuff so she's got turkey and pilgrim socks for all of november and little snow flake and christmas trees for december. I love her she's such a riot